C18H19N3O3S — CID 46445779
N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methoxy-1H-indole-2-carbohydrazide (PubChem CID 46445779) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methoxy-1H-indole-2-carbohydrazide.
| Compound Name | N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methoxy-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 46445779 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methoxy-1H-indole-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2cc3ccc(OC)cc3[nH]2)cc1C |
| InChI | InChI=1S/C18H19N3O3S/c1-4-15-10(2)7-16(25-15)18(23)21-20-17(22)14-8-11-5-6-12(24-3)9-13(11)19-14/h5-9,19H,4H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | UTADTJYFELKWHX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|