C23H23N3O6S — CID 139895013
2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-[[2-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]methyl]amino]acetamide (PubChem CID 139895013) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-[[2-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]methyl]amino]acetamide.
| Compound Name | 2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-[[2-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 139895013 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-[[2-[(E)-2-(1-oxidopyridin-1-ium-4-yl)ethenyl]phenyl]methyl]amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2/C=C/c2cc[n+]([O-])cc2)C(O)C(N)=O)cc1 |
| InChI | InChI=1S/C23H23N3O6S/c1-32-20-8-10-21(11-9-20)33(30,31)26(23(28)22(24)27)16-19-5-3-2-4-18(19)7-6-17-12-14-25(29)15-13-17/h2-15,23,28H,16H2,1H3,(H2,24,27)/b7-6+ |
| InChIKey | DKFJDUWTPVFAQF-VOTSOKGWSA-N |
| XLogP | 1.49 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|