C21H20N4O6S — CID 139894958
N-[2-[(2-amino-2-oxoethyl)-(4-methoxyphenyl)sulfonylamino]phenyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 139894958) has the molecular formula C21H20N4O6S and a molecular weight of 456.48 g/mol. Its IUPAC name is N-[2-[(2-amino-2-oxoethyl)-(4-methoxyphenyl)sulfonylamino]phenyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[2-[(2-amino-2-oxoethyl)-(4-methoxyphenyl)sulfonylamino]phenyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 139894958 |
| Molecular Formula | C21H20N4O6S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-[2-[(2-amino-2-oxoethyl)-(4-methoxyphenyl)sulfonylamino]phenyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(N)=O)c2ccccc2NC(=O)c2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C21H20N4O6S/c1-31-16-6-8-17(9-7-16)32(29,30)25(14-20(22)26)19-5-3-2-4-18(19)23-21(27)15-10-12-24(28)13-11-15/h2-13H,14H2,1H3,(H2,22,26)(H,23,27) |
| InChIKey | JWJWKDYRJYWMQN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|