C27H31N3O6S — CID 2943245
N-butan-2-yl-2-[[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 2943245) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-2-[[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2943245 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-butan-2-yl-2-[[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)CN(c1ccccc1OC)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H31N3O6S/c1-5-19(2)28-27(32)22-10-6-7-11-23(22)29-26(31)18-30(24-12-8-9-13-25(24)36-4)37(33,34)21-16-14-20(35-3)15-17-21/h6-17,19H,5,18H2,1-4H3,(H,28,32)(H,29,31) |
| InChIKey | UTKJKBRIMXCWGE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |