C25H26ClN3O4S — CID 1317744
2-[[2-[N-(benzenesulfonyl)-2-chloroanilino]acetyl]amino]-N-[(2R)-butan-2-yl]benzamide (PubChem CID 1317744) has the molecular formula C25H26ClN3O4S and a molecular weight of 500.02 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2-chloroanilino]acetyl]amino]-N-[(2R)-butan-2-yl]benzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2-chloroanilino]acetyl]amino]-N-[(2R)-butan-2-yl]benzamide |
|---|---|
| PubChem CID | 1317744 |
| Molecular Formula | C25H26ClN3O4S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2-chloroanilino]acetyl]amino]-N-[(2R)-butan-2-yl]benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1ccccc1NC(=O)CN(c1ccccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26ClN3O4S/c1-3-18(2)27-25(31)20-13-7-9-15-22(20)28-24(30)17-29(23-16-10-8-14-21(23)26)34(32,33)19-11-5-4-6-12-19/h4-16,18H,3,17H2,1-2H3,(H,27,31)(H,28,30)/t18-/m1/s1 |
| InChIKey | LDFOWXAXLYVVPQ-GOSISDBHSA-N |
| XLogP | 4.70 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |