C26H28FN3O5S — CID 30276214
N-tert-butyl-2-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 30276214) has the molecular formula C26H28FN3O5S and a molecular weight of 513.59 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-2-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 30276214 |
| Molecular Formula | C26H28FN3O5S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-tert-butyl-2-[[2-(2-fluoro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2C(=O)NC(C)(C)C)c2ccccc2F)cc1 |
| InChI | InChI=1S/C26H28FN3O5S/c1-26(2,3)29-25(32)20-9-5-7-11-22(20)28-24(31)17-30(23-12-8-6-10-21(23)27)36(33,34)19-15-13-18(35-4)14-16-19/h5-16H,17H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | CCZHXMBGJJHNRN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |