C21H19N3O5S — CID 129225457
2-[N-(benzenesulfonyl)-2-formyl-5-methoxyanilino]-N-pyridin-3-ylacetamide (PubChem CID 129225457) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-formyl-5-methoxyanilino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-formyl-5-methoxyanilino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 129225457 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-formyl-5-methoxyanilino]-N-pyridin-3-ylacetamide |
| SMILES | COc1ccc(C=O)c(N(CC(=O)Nc2cccnc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3O5S/c1-29-18-10-9-16(15-25)20(12-18)24(30(27,28)19-7-3-2-4-8-19)14-21(26)23-17-6-5-11-22-13-17/h2-13,15H,14H2,1H3,(H,23,26) |
| InChIKey | PFTFLODEQBBCRH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|