C29H28N2O6S — CID 2469146
3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(2,5-dimethoxyphenyl)benzamide (PubChem CID 2469146) has the molecular formula C29H28N2O6S and a molecular weight of 532.62 g/mol. Its IUPAC name is 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(2,5-dimethoxyphenyl)benzamide.
| Compound Name | 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(2,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2469146 |
| Molecular Formula | C29H28N2O6S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(2,5-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(S(=O)(=O)N(Cc3ccccc3)c3ccccc3OC)c2)c1 |
| InChI | InChI=1S/C29H28N2O6S/c1-35-23-16-17-27(36-2)25(19-23)30-29(32)22-12-9-13-24(18-22)38(33,34)31(20-21-10-5-4-6-11-21)26-14-7-8-15-28(26)37-3/h4-19H,20H2,1-3H3,(H,30,32) |
| InChIKey | CHQRVYQZUFNEAB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |