C31H33N3O4S — CID 2433943
3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-[4-(diethylamino)phenyl]benzamide (PubChem CID 2433943) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-[4-(diethylamino)phenyl]benzamide.
| Compound Name | 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-[4-(diethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 2433943 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-[4-(diethylamino)phenyl]benzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cccc(S(=O)(=O)N(Cc3ccccc3)c3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C31H33N3O4S/c1-4-33(5-2)27-20-18-26(19-21-27)32-31(35)25-14-11-15-28(22-25)39(36,37)34(23-24-12-7-6-8-13-24)29-16-9-10-17-30(29)38-3/h6-22H,4-5,23H2,1-3H3,(H,32,35) |
| InChIKey | QRPKRFGLYUSYON-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|