C24H21N3O4S2 — CID 2079702
3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 2079702) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2079702 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 3-[benzyl-(2-methoxyphenyl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1ccccc1N(Cc1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-31-22-13-6-5-12-21(22)27(17-18-8-3-2-4-9-18)33(29,30)20-11-7-10-19(16-20)23(28)26-24-25-14-15-32-24/h2-16H,17H2,1H3,(H,25,26,28) |
| InChIKey | NMBQTVAPXUCXRN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |