C22H24N4S — CID 135758726
1-cyclohexyl-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea (PubChem CID 135758726) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135758726 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]thiourea |
| SMILES | S=C(N/N=C/c1c(-c2ccccc2)[nH]c2ccccc12)NC1CCCCC1 |
| InChI | InChI=1S/C22H24N4S/c27-22(24-17-11-5-2-6-12-17)26-23-15-19-18-13-7-8-14-20(18)25-21(19)16-9-3-1-4-10-16/h1,3-4,7-10,13-15,17,25H,2,5-6,11-12H2,(H2,24,26,27)/b23-15+ |
| InChIKey | PJNWVJOEKFSGPA-HZHRSRAPSA-N |
| XLogP | 4.97 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|