C19H23N5S — CID 170856640
1-[(Z)-[amino-(4-phenyl-2-pyridinyl)methylidene]amino]-3-cyclohexylthiourea (PubChem CID 170856640) has the molecular formula C19H23N5S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-[(Z)-[amino-(4-phenyl-2-pyridinyl)methylidene]amino]-3-cyclohexylthiourea.
| Compound Name | 1-[(Z)-[amino-(4-phenyl-2-pyridinyl)methylidene]amino]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 170856640 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[(Z)-[amino-(4-phenyl-2-pyridinyl)methylidene]amino]-3-cyclohexylthiourea |
| SMILES | N/C(=N\NC(=S)NC1CCCCC1)c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C19H23N5S/c20-18(23-24-19(25)22-16-9-5-2-6-10-16)17-13-15(11-12-21-17)14-7-3-1-4-8-14/h1,3-4,7-8,11-13,16H,2,5-6,9-10H2,(H2,20,23)(H2,22,24,25) |
| InChIKey | XLFUCJBDFRTPKW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|