C12H9ClN6OS — CID 65452578
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-hydrazinylpyridine-3-carboxamide (PubChem CID 65452578) has the molecular formula C12H9ClN6OS and a molecular weight of 320.77 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 65452578 |
| Molecular Formula | C12H9ClN6OS |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-hydrazinylpyridine-3-carboxamide |
| SMILES | NNc1ncccc1C(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C12H9ClN6OS/c13-7-3-4-8-10(19-21-18-8)9(7)16-12(20)6-2-1-5-15-11(6)17-14/h1-5H,14H2,(H,15,17)(H,16,20) |
| InChIKey | VRBZCAKASORVSJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|