C13H9ClN4OS — CID 2038732
2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide (PubChem CID 2038732) has the molecular formula C13H9ClN4OS and a molecular weight of 304.76 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2038732 |
| Molecular Formula | C13H9ClN4OS |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-chloro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide |
| SMILES | Cc1ccc2nsnc2c1NC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H9ClN4OS/c1-7-4-5-9-11(18-20-17-9)10(7)16-13(19)8-3-2-6-15-12(8)14/h2-6H,1H3,(H,16,19) |
| InChIKey | SEBKFLBPORXNDJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|