C16H14ClN3O2S — CID 5091717
3-chloro-4-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide (PubChem CID 5091717) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide.
| Compound Name | 3-chloro-4-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 5091717 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 3-chloro-4-ethoxy-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2c(C)ccc3nsnc23)cc1Cl |
| InChI | InChI=1S/C16H14ClN3O2S/c1-3-22-13-7-5-10(8-11(13)17)16(21)18-14-9(2)4-6-12-15(14)20-23-19-12/h4-8H,3H2,1-2H3,(H,18,21) |
| InChIKey | RBADTROJBNDVET-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |