C12H13ClN2O2S — CID 960169
3-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-4-ethoxybenzamide (PubChem CID 960169) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-4-ethoxybenzamide.
| Compound Name | 3-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 960169 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-chloro-N-(4,5-dihydro-1,3-thiazol-2-yl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC2=NCCS2)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O2S/c1-2-17-10-4-3-8(7-9(10)13)11(16)15-12-14-5-6-18-12/h3-4,7H,2,5-6H2,1H3,(H,14,15,16) |
| InChIKey | IAMOBGNZPHVBRC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |