C9H7ClN4OS — CID 115661246
2-chloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-3-carboxamide (PubChem CID 115661246) has the molecular formula C9H7ClN4OS and a molecular weight of 254.70 g/mol. Its IUPAC name is 2-chloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115661246 |
| Molecular Formula | C9H7ClN4OS |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 2-chloro-N-(3-methyl-1,2,4-thiadiazol-5-yl)pyridine-3-carboxamide |
| SMILES | Cc1nsc(NC(=O)c2cccnc2Cl)n1 |
| InChI | InChI=1S/C9H7ClN4OS/c1-5-12-9(16-14-5)13-8(15)6-3-2-4-11-7(6)10/h2-4H,1H3,(H,12,13,14,15) |
| InChIKey | FSEILQQLLBNNOS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|