C14H11BrFNO3 — CID 104889817
N-(4-bromo-5-fluoro-2-methylphenyl)-3,5-dihydroxybenzamide (PubChem CID 104889817) has the molecular formula C14H11BrFNO3 and a molecular weight of 340.15 g/mol. Its IUPAC name is N-(4-bromo-5-fluoro-2-methylphenyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104889817 |
| Molecular Formula | C14H11BrFNO3 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3,5-dihydroxybenzamide |
| SMILES | Cc1cc(Br)c(F)cc1NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H11BrFNO3/c1-7-2-11(15)12(16)6-13(7)17-14(20)8-3-9(18)5-10(19)4-8/h2-6,18-19H,1H3,(H,17,20) |
| InChIKey | VXVYEGYVQIOACW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |