About 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine
6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 80919229) has the molecular formula C10H8F3N5
and a molecular weight of 255.20 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
| PubChem CID | 80919229 |
| Molecular Formula | C10H8F3N5 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | NNc1cc(Nc2cc(F)cc(F)c2F)ncn1 |
| InChI | InChI=1S/C10H8F3N5/c11-5-1-6(12)10(13)7(2-5)17-8-3-9(18-14)16-4-15-8/h1-4H,14H2,(H2,15,16,17,18) |
| InChIKey | KXCDRUCNSQOMGW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine?
The IUPAC name of 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine (CID 80919229) is 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine.
What is the SMILES notation for 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine?
The canonical SMILES for 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine is NNc1cc(Nc2cc(F)cc(F)c2F)ncn1.
What is the InChIKey of 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine?
The InChIKey is KXCDRUCNSQOMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N5/c11-5-1-6(12)10(13)7(2-5)17-8-3-9(18-14)16-4-15-8/h1-4H,14H2,(H2,15,16,17,18).
What are the key properties of 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine?
6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine has a molecular weight of 255.20 g/mol, XLogP of 1.92, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine is sourced from PubChem (CID 80919229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).