C11H11BrN6O2 — CID 80920273
N-(4-bromo-3-methylphenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 80920273) has the molecular formula C11H11BrN6O2 and a molecular weight of 339.15 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-bromo-3-methylphenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80920273 |
| Molecular Formula | C11H11BrN6O2 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ncnc(NN)c2[N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C11H11BrN6O2/c1-6-4-7(2-3-8(6)12)16-10-9(18(19)20)11(17-13)15-5-14-10/h2-5H,13H2,1H3,(H2,14,15,16,17) |
| InChIKey | HVHZJPONJJVDSB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|