C10H8BrClN6O2 — CID 107617966
N-(4-bromo-3-chlorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 107617966) has the molecular formula C10H8BrClN6O2 and a molecular weight of 359.57 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-bromo-3-chlorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 107617966 |
| Molecular Formula | C10H8BrClN6O2 |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | NNc1ncnc(Nc2ccc(Br)c(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8BrClN6O2/c11-6-2-1-5(3-7(6)12)16-9-8(18(19)20)10(17-13)15-4-14-9/h1-4H,13H2,(H2,14,15,16,17) |
| InChIKey | QELSTNAKWOHVOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|