C18H12F2N6O3S — CID 22535221
6-N-(2,4-difluorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22535221) has the molecular formula C18H12F2N6O3S and a molecular weight of 430.40 g/mol. Its IUPAC name is 6-N-(2,4-difluorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,4-difluorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22535221 |
| Molecular Formula | C18H12F2N6O3S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 6-N-(2,4-difluorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc2nc(Nc3ncnc(Nc4ccc(F)cc4F)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C18H12F2N6O3S/c1-29-10-3-5-13-14(7-10)30-18(24-13)25-17-15(26(27)28)16(21-8-22-17)23-12-4-2-9(19)6-11(12)20/h2-8H,1H3,(H2,21,22,23,24,25) |
| InChIKey | SLWZQPRMOQQOEC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|