C19H16Cl2N6O3 — CID 23478056
N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 23478056) has the molecular formula C19H16Cl2N6O3 and a molecular weight of 447.28 g/mol. Its IUPAC name is N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 23478056 |
| Molecular Formula | C19H16Cl2N6O3 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | CN(Cc1ccccc1)c1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16Cl2N6O3/c1-26(10-12-5-3-2-4-6-12)18-16(27(29)30)17(22-11-23-18)24-25-19(28)14-8-7-13(20)9-15(14)21/h2-9,11H,10H2,1H3,(H,25,28)(H,22,23,24) |
| InChIKey | IMPQRAOEBVQBHN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|