C23H20N6O3 — CID 23478055
N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide (PubChem CID 23478055) has the molecular formula C23H20N6O3 and a molecular weight of 428.45 g/mol. Its IUPAC name is N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide.
| Compound Name | N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 23478055 |
| Molecular Formula | C23H20N6O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N'-[6-[benzyl(methyl)amino]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide |
| SMILES | CN(Cc1ccccc1)c1ncnc(NNC(=O)c2cccc3ccccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N6O3/c1-28(14-16-8-3-2-4-9-16)22-20(29(31)32)21(24-15-25-22)26-27-23(30)19-13-7-11-17-10-5-6-12-18(17)19/h2-13,15H,14H2,1H3,(H,27,30)(H,24,25,26) |
| InChIKey | SOMIMSQZSLPEPP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|