C21H13Cl2N5O4 — CID 23479972
2,4-dichloro-N'-(6-naphthalen-1-yloxy-5-nitropyrimidin-4-yl)benzohydrazide (PubChem CID 23479972) has the molecular formula C21H13Cl2N5O4 and a molecular weight of 470.27 g/mol. Its IUPAC name is 2,4-dichloro-N'-(6-naphthalen-1-yloxy-5-nitropyrimidin-4-yl)benzohydrazide.
| Compound Name | 2,4-dichloro-N'-(6-naphthalen-1-yloxy-5-nitropyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 23479972 |
| Molecular Formula | C21H13Cl2N5O4 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2,4-dichloro-N'-(6-naphthalen-1-yloxy-5-nitropyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc(Oc2cccc3ccccc23)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H13Cl2N5O4/c22-13-8-9-15(16(23)10-13)20(29)27-26-19-18(28(30)31)21(25-11-24-19)32-17-7-3-5-12-4-1-2-6-14(12)17/h1-11H,(H,27,29)(H,24,25,26) |
| InChIKey | VJJSZWQGTORUDC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|