C15H16Cl2N6O3 — CID 23478781
N'-[6-(tert-butylamino)-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 23478781) has the molecular formula C15H16Cl2N6O3 and a molecular weight of 399.24 g/mol. Its IUPAC name is N'-[6-(tert-butylamino)-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[6-(tert-butylamino)-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 23478781 |
| Molecular Formula | C15H16Cl2N6O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N'-[6-(tert-butylamino)-5-nitropyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | CC(C)(C)Nc1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16Cl2N6O3/c1-15(2,3)20-12-11(23(25)26)13(19-7-18-12)21-22-14(24)9-5-4-8(16)6-10(9)17/h4-7H,1-3H3,(H,22,24)(H2,18,19,20,21) |
| InChIKey | CPNANBJXHYQRQP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|