C14H9Cl2N7O2 — CID 23483512
2-[cyanomethyl-[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile (PubChem CID 23483512) has the molecular formula C14H9Cl2N7O2 and a molecular weight of 378.18 g/mol. Its IUPAC name is 2-[cyanomethyl-[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 23483512 |
| Molecular Formula | C14H9Cl2N7O2 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-[cyanomethyl-[6-(3,5-dichloroanilino)-5-nitropyrimidin-4-yl]amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1ncnc(Nc2cc(Cl)cc(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9Cl2N7O2/c15-9-5-10(16)7-11(6-9)21-13-12(23(24)25)14(20-8-19-13)22(3-1-17)4-2-18/h5-8H,3-4H2,(H,19,20,21) |
| InChIKey | YKRKNALVKJCLCY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|