C19H14BrN7O3 — CID 23493549
3-[[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile (PubChem CID 23493549) has the molecular formula C19H14BrN7O3 and a molecular weight of 468.27 g/mol. Its IUPAC name is 3-[[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile.
| Compound Name | 3-[[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 23493549 |
| Molecular Formula | C19H14BrN7O3 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 3-[[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
| SMILES | N#CCCN(CCC#N)c1ncnc(Oc2ccc(Br)c3cccnc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14BrN7O3/c20-14-5-6-15(16-13(14)4-1-9-23-16)30-19-17(27(28)29)18(24-12-25-19)26(10-2-7-21)11-3-8-22/h1,4-6,9,12H,2-3,10-11H2 |
| InChIKey | AUXZSCCZTJNVDY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 141.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|