C17H13F3N6O2 — CID 23481398
5-nitro-6-N-(pyridin-3-ylmethyl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (PubChem CID 23481398) has the molecular formula C17H13F3N6O2 and a molecular weight of 390.33 g/mol. Its IUPAC name is 5-nitro-6-N-(pyridin-3-ylmethyl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-6-N-(pyridin-3-ylmethyl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23481398 |
| Molecular Formula | C17H13F3N6O2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 5-nitro-6-N-(pyridin-3-ylmethyl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCc2cccnc2)ncnc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N6O2/c18-17(19,20)12-3-5-13(6-4-12)25-16-14(26(27)28)15(23-10-24-16)22-9-11-2-1-7-21-8-11/h1-8,10H,9H2,(H2,22,23,24,25) |
| InChIKey | HFIRWZLJRCXGCN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|