C19H18N6O4 — CID 11728952
N-(1,3-benzodioxol-5-yl)-6-nitro-7-piperazin-1-ylquinazolin-4-amine (PubChem CID 11728952) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-nitro-7-piperazin-1-ylquinazolin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-nitro-7-piperazin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 11728952 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-nitro-7-piperazin-1-ylquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(Nc3ccc4c(c3)OCO4)ncnc2cc1N1CCNCC1 |
| InChI | InChI=1S/C19H18N6O4/c26-25(27)16-8-13-14(9-15(16)24-5-3-20-4-6-24)21-10-22-19(13)23-12-1-2-17-18(7-12)29-11-28-17/h1-2,7-10,20H,3-6,11H2,(H,21,22,23) |
| InChIKey | YCWSYROPJLIHGA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|