C24H26N6O6 — CID 101258378
ethyl 2-[1,3-benzodioxol-5-ylmethyl-(6-nitro-7-piperazin-1-ylquinazolin-4-yl)amino]acetate (PubChem CID 101258378) has the molecular formula C24H26N6O6 and a molecular weight of 494.51 g/mol. Its IUPAC name is ethyl 2-[1,3-benzodioxol-5-ylmethyl-(6-nitro-7-piperazin-1-ylquinazolin-4-yl)amino]acetate.
| Compound Name | ethyl 2-[1,3-benzodioxol-5-ylmethyl-(6-nitro-7-piperazin-1-ylquinazolin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 101258378 |
| Molecular Formula | C24H26N6O6 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | ethyl 2-[1,3-benzodioxol-5-ylmethyl-(6-nitro-7-piperazin-1-ylquinazolin-4-yl)amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccc2c(c1)OCO2)c1ncnc2cc(N3CCNCC3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C24H26N6O6/c1-2-34-23(31)13-29(12-16-3-4-21-22(9-16)36-15-35-21)24-17-10-20(30(32)33)19(11-18(17)26-14-27-24)28-7-5-25-6-8-28/h3-4,9-11,14,25H,2,5-8,12-13,15H2,1H3 |
| InChIKey | AFWGAAUCDDFMTN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|