C23H27N7O3 — CID 70099558
4-[2-(2-methoxyphenyl)piperazin-1-yl]-6-nitro-7-piperazin-1-ylquinazoline (PubChem CID 70099558) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 4-[2-(2-methoxyphenyl)piperazin-1-yl]-6-nitro-7-piperazin-1-ylquinazoline.
| Compound Name | 4-[2-(2-methoxyphenyl)piperazin-1-yl]-6-nitro-7-piperazin-1-ylquinazoline |
|---|---|
| PubChem CID | 70099558 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[2-(2-methoxyphenyl)piperazin-1-yl]-6-nitro-7-piperazin-1-ylquinazoline |
| SMILES | COc1ccccc1C1CNCCN1c1ncnc2cc(N3CCNCC3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C23H27N7O3/c1-33-22-5-3-2-4-16(22)21-14-25-8-11-29(21)23-17-12-20(30(31)32)19(13-18(17)26-15-27-23)28-9-6-24-7-10-28/h2-5,12-13,15,21,24-25H,6-11,14H2,1H3 |
| InChIKey | FHQZPDUCGIGVQP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|