C18H20N4O4 — CID 120733983
[2-(2-methoxyphenyl)piperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone (PubChem CID 120733983) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)piperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone.
| Compound Name | [2-(2-methoxyphenyl)piperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 120733983 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [2-(2-methoxyphenyl)piperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1cc([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C18H20N4O4/c1-12-15(9-13(10-20-12)22(24)25)18(23)21-8-7-19-11-16(21)14-5-3-4-6-17(14)26-2/h3-6,9-10,16,19H,7-8,11H2,1-2H3 |
| InChIKey | NKNQFKBCFSYZKS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|