C17H22ClN5O4 — CID 120734599
(1,3-dimethyl-4-nitropyrazol-5-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120734599) has the molecular formula C17H22ClN5O4 and a molecular weight of 395.85 g/mol. Its IUPAC name is (1,3-dimethyl-4-nitropyrazol-5-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120734599 |
| Molecular Formula | C17H22ClN5O4 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1c([N+](=O)[O-])c(C)nn1C.Cl |
| InChI | InChI=1S/C17H21N5O4.ClH/c1-11-15(22(24)25)16(20(2)19-11)17(23)21-9-8-18-10-13(21)12-6-4-5-7-14(12)26-3;/h4-7,13,18H,8-10H2,1-3H3;1H |
| InChIKey | KFIUOJJRLSWMFI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|