C17H22ClN3O2 — CID 120734744
[2-(2-methoxyphenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride (PubChem CID 120734744) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [2-(2-methoxyphenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120734744 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [2-(2-methoxyphenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1cccn1C.Cl |
| InChI | InChI=1S/C17H21N3O2.ClH/c1-19-10-5-7-14(19)17(21)20-11-9-18-12-15(20)13-6-3-4-8-16(13)22-2;/h3-8,10,15,18H,9,11-12H2,1-2H3;1H |
| InChIKey | CDRVVYMSIOSADP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |