C16H21Cl2N5O2 — CID 120735210
(3-aminopyrazin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 120735210) has the molecular formula C16H21Cl2N5O2 and a molecular weight of 386.28 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminopyrazin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120735210 |
| Molecular Formula | C16H21Cl2N5O2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1nccnc1N.Cl.Cl |
| InChI | InChI=1S/C16H19N5O2.2ClH/c1-23-13-5-3-2-4-11(13)12-10-18-8-9-21(12)16(22)14-15(17)20-7-6-19-14;;/h2-7,12,18H,8-10H2,1H3,(H2,17,20);2*1H |
| InChIKey | WQZUXRWNBHWQAZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |