C15H18Cl2FN5O — CID 120737871
(3-aminopyrazin-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 120737871) has the molecular formula C15H18Cl2FN5O and a molecular weight of 374.25 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminopyrazin-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120737871 |
| Molecular Formula | C15H18Cl2FN5O |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1nccnc1C(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H16FN5O.2ClH/c16-11-3-1-2-10(8-11)12-9-18-6-7-21(12)15(22)13-14(17)20-5-4-19-13;;/h1-5,8,12,18H,6-7,9H2,(H2,17,20);2*1H |
| InChIKey | XIHUCFNYZZJOGA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |