C21H23FN6O2 — CID 70102462
N-[3-(2-fluorophenyl)propyl]-6-nitro-7-piperazin-1-ylquinazolin-4-amine (PubChem CID 70102462) has the molecular formula C21H23FN6O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[3-(2-fluorophenyl)propyl]-6-nitro-7-piperazin-1-ylquinazolin-4-amine.
| Compound Name | N-[3-(2-fluorophenyl)propyl]-6-nitro-7-piperazin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 70102462 |
| Molecular Formula | C21H23FN6O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[3-(2-fluorophenyl)propyl]-6-nitro-7-piperazin-1-ylquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(NCCCc3ccccc3F)ncnc2cc1N1CCNCC1 |
| InChI | InChI=1S/C21H23FN6O2/c22-17-6-2-1-4-15(17)5-3-7-24-21-16-12-20(28(29)30)19(13-18(16)25-14-26-21)27-10-8-23-9-11-27/h1-2,4,6,12-14,23H,3,5,7-11H2,(H,24,25,26) |
| InChIKey | QYMGTZBYFUQOCE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|