C18H17N3O2 — CID 24607854
N-(1,3-benzodioxol-5-ylmethyl)-N-ethylquinazolin-4-amine (PubChem CID 24607854) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-ethylquinazolin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethylquinazolin-4-amine |
|---|---|
| PubChem CID | 24607854 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethylquinazolin-4-amine |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)c1ncnc2ccccc12 |
| InChI | InChI=1S/C18H17N3O2/c1-2-21(10-13-7-8-16-17(9-13)23-12-22-16)18-14-5-3-4-6-15(14)19-11-20-18/h3-9,11H,2,10,12H2,1H3 |
| InChIKey | IYPUWMRNCCBRMN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |