C19H18N4O3 — CID 110436193
N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-ylamino)propanamide (PubChem CID 110436193) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-ylamino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-ylamino)propanamide |
|---|---|
| PubChem CID | 110436193 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(quinazolin-4-ylamino)propanamide |
| SMILES | CC(Nc1ncnc2ccccc12)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N4O3/c1-12(23-18-14-4-2-3-5-15(14)21-10-22-18)19(24)20-9-13-6-7-16-17(8-13)26-11-25-16/h2-8,10,12H,9,11H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | LLTMIOHBDVOTDZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |