C19H20N2O5 — CID 2566489
(2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-phenoxyacetyl)amino]propanamide (PubChem CID 2566489) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-phenoxyacetyl)amino]propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-phenoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 2566489 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-phenoxyacetyl)amino]propanamide |
| SMILES | C[C@@H](NC(=O)COc1ccccc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O5/c1-13(21-18(22)11-24-15-5-3-2-4-6-15)19(23)20-10-14-7-8-16-17(9-14)26-12-25-16/h2-9,13H,10-12H2,1H3,(H,20,23)(H,21,22)/t13-/m1/s1 |
| InChIKey | BLEITXDCKVJYKO-CYBMUJFWSA-N |
| XLogP | 1.62 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |