C13H12N4O4 — CID 2858015
N-(3,5-dimethylphenyl)-3,5-dinitropyridin-2-amine (PubChem CID 2858015) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3,5-dinitropyridin-2-amine.
| Compound Name | N-(3,5-dimethylphenyl)-3,5-dinitropyridin-2-amine |
|---|---|
| PubChem CID | 2858015 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3,5-dinitropyridin-2-amine |
| SMILES | Cc1cc(C)cc(Nc2ncc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N4O4/c1-8-3-9(2)5-10(4-8)15-13-12(17(20)21)6-11(7-14-13)16(18)19/h3-7H,1-2H3,(H,14,15) |
| InChIKey | VFBFWGLJUSYCOF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|