C13H11Cl2N3O2 — CID 28544299
N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-5-nitropyridin-2-amine (PubChem CID 28544299) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 28544299 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-5-nitropyridin-2-amine |
| SMILES | C[C@H](Nc1ccc([N+](=O)[O-])cn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O2/c1-8(11-4-2-9(14)6-12(11)15)17-13-5-3-10(7-16-13)18(19)20/h2-8H,1H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | MECIHSPPVZNTDE-QMMMGPOBSA-N |
| XLogP | 4.47 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|