C24H17Cl2N7O2 — CID 173279091
N-[1-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine (PubChem CID 173279091) has the molecular formula C24H17Cl2N7O2 and a molecular weight of 506.35 g/mol. Its IUPAC name is N-[1-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[1-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 173279091 |
| Molecular Formula | C24H17Cl2N7O2 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | N-[1-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine |
| SMILES | CC(Nc1ccc([N+](=O)[O-])cn1)c1ncc(-n2cnc3ccccc32)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C24H17Cl2N7O2/c1-14(30-22-9-7-16(11-27-22)33(34)35)24-28-12-21(32-13-29-19-4-2-3-5-20(19)32)23(31-24)17-8-6-15(25)10-18(17)26/h2-14H,1H3,(H,27,30) |
| InChIKey | MGUOLTRIPVZLSQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|