C18H16Cl2N4O2 — CID 141085826
N-[3-[3-(2,4-dichlorophenyl)pyrrol-1-yl]propyl]-5-nitropyridin-2-amine (PubChem CID 141085826) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is N-[3-[3-(2,4-dichlorophenyl)pyrrol-1-yl]propyl]-5-nitropyridin-2-amine.
| Compound Name | N-[3-[3-(2,4-dichlorophenyl)pyrrol-1-yl]propyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 141085826 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-[3-[3-(2,4-dichlorophenyl)pyrrol-1-yl]propyl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCCn2ccc(-c3ccc(Cl)cc3Cl)c2)nc1 |
| InChI | InChI=1S/C18H16Cl2N4O2/c19-14-2-4-16(17(20)10-14)13-6-9-23(12-13)8-1-7-21-18-5-3-15(11-22-18)24(25)26/h2-6,9-12H,1,7-8H2,(H,21,22) |
| InChIKey | PJJXAPKXCPLODI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|