C16H18N4O2 — CID 34058867
N-[3-(2,3-dihydroindol-1-yl)propyl]-5-nitropyridin-2-amine (PubChem CID 34058867) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-5-nitropyridin-2-amine.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 34058867 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCCN2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C16H18N4O2/c21-20(22)14-6-7-16(18-12-14)17-9-3-10-19-11-8-13-4-1-2-5-15(13)19/h1-2,4-7,12H,3,8-11H2,(H,17,18) |
| InChIKey | DFQDATUNMFLWFU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|