C20H26N4O — CID 135114633
6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 135114633) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 135114633 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 6-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NCCCN2CCCc3ccccc32)nc1 |
| InChI | InChI=1S/C20H26N4O/c1-23(2)20(25)17-10-11-19(22-15-17)21-12-6-14-24-13-5-8-16-7-3-4-9-18(16)24/h3-4,7,9-11,15H,5-6,8,12-14H2,1-2H3,(H,21,22) |
| InChIKey | WUNWUWWJNPDXLR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|