C20H26N6 — CID 133489463
3-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133489463) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133489463 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CC(C)(C)c1nnc2ccc(NCCCN3CCc4ccccc43)nn12 |
| InChI | InChI=1S/C20H26N6/c1-20(2,3)19-23-22-18-10-9-17(24-26(18)19)21-12-6-13-25-14-11-15-7-4-5-8-16(15)25/h4-5,7-10H,6,11-14H2,1-3H3,(H,21,24) |
| InChIKey | KGHUVSIQXFAIJA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|