C11H14F3N5O — CID 107302564
5-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]pentan-1-ol (PubChem CID 107302564) has the molecular formula C11H14F3N5O and a molecular weight of 289.26 g/mol. Its IUPAC name is 5-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]pentan-1-ol.
| Compound Name | 5-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107302564 |
| Molecular Formula | C11H14F3N5O |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-[[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino]pentan-1-ol |
| SMILES | OCCCCCNc1ccc2nnc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C11H14F3N5O/c12-11(13,14)10-17-16-9-5-4-8(18-19(9)10)15-6-2-1-3-7-20/h4-5,20H,1-3,6-7H2,(H,15,18) |
| InChIKey | VOVOTUJLKSBOOM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|