C12H16F3N5S — CID 133275911
N-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133275911) has the molecular formula C12H16F3N5S and a molecular weight of 319.36 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133275911 |
| Molecular Formula | C12H16F3N5S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CC(C)(C)SCCNc1ccc2nnc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C12H16F3N5S/c1-11(2,3)21-7-6-16-8-4-5-9-17-18-10(12(13,14)15)20(9)19-8/h4-5H,6-7H2,1-3H3,(H,16,19) |
| InChIKey | FIDRTDYEMOWWJH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|